sheirosado03 sheirosado03

01-09-2021
Mathematics

contestada

Write -70.075 as a mixed number.

Respuesta :

Annyohasayo Annyohasayo

01-09-2021

Answer:

-70.075

Step-by-step explanation:

it's answer hope it helps you

Answer Link

Otras preguntas

1+1. Диппцташцщткьдлзущущлрлщуищуи

a 70 kg runner exerts a force of 35n. what is the acceleration of the runner

List three halogens, and describe a property that they all share.

cosec(6b+pi/8)=sec(2b-pi/8)

what is 3 7/8 + 2 5/6 =

Which of the following expressions demonstrates the distributive property? 3 + 4 + 5 = 4 + 3 + 5 -2(5 + 7) = -2(7 + 5) 3(-8 + 1) = 3(-8) + 3(1) 6[(7)(-2)] =

What is cilia and scourges in biology?

Chris runs a small business. She always seems to come up with original and effective new ideas. As an entrepreneur Chris is highly what?

During a chemical change, substances react to form a new substance. Some signs of chemical change are gas formation, a change in color, or the production of hea

Triangle and triangle are similar. What is the measure of side ?